C16H21F3N2O3 — CID 113061526
tert-butyl N-[2-[N-acetyl-4-(trifluoromethyl)anilino]ethyl]carbamate (PubChem CID 113061526) has the molecular formula C16H21F3N2O3 and a molecular weight of 346.35 g/mol. Its IUPAC name is tert-butyl N-[2-[N-acetyl-4-(trifluoromethyl)anilino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[N-acetyl-4-(trifluoromethyl)anilino]ethyl]carbamate |
|---|---|
| PubChem CID | 113061526 |
| Molecular Formula | C16H21F3N2O3 |
| Molecular Weight | 346.35 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | tert-butyl N-[2-[N-acetyl-4-(trifluoromethyl)anilino]ethyl]carbamate |
| SMILES | CC(=O)N(CCNC(=O)OC(C)(C)C)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H21F3N2O3/c1-11(22)21(10-9-20-14(23)24-15(2,3)4)13-7-5-12(6-8-13)16(17,18)19/h5-8H,9-10H2,1-4H3,(H,20,23) |
| InChIKey | XRQWTADXUMYBDZ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.35 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |