C21H33N3O3 — CID 113062437
tert-butyl N-[2-[N-acetyl-4-(4-methylpiperidin-1-yl)anilino]ethyl]carbamate (PubChem CID 113062437) has the molecular formula C21H33N3O3 and a molecular weight of 375.51 g/mol. Its IUPAC name is tert-butyl N-[2-[N-acetyl-4-(4-methylpiperidin-1-yl)anilino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[N-acetyl-4-(4-methylpiperidin-1-yl)anilino]ethyl]carbamate |
|---|---|
| PubChem CID | 113062437 |
| Molecular Formula | C21H33N3O3 |
| Molecular Weight | 375.51 g/mol |
| Exact Mass | 375.25 |
| IUPAC Name | tert-butyl N-[2-[N-acetyl-4-(4-methylpiperidin-1-yl)anilino]ethyl]carbamate |
| SMILES | CC(=O)N(CCNC(=O)OC(C)(C)C)c1ccc(N2CCC(C)CC2)cc1 |
| InChI | InChI=1S/C21H33N3O3/c1-16-10-13-23(14-11-16)18-6-8-19(9-7-18)24(17(2)25)15-12-22-20(26)27-21(3,4)5/h6-9,16H,10-15H2,1-5H3,(H,22,26) |
| InChIKey | FRDOOGLOLQSVGU-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.51 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|