C17H26N2O5 — CID 113061339
tert-butyl N-[2-(N-acetyl-3,4-dimethoxyanilino)ethyl]carbamate (PubChem CID 113061339) has the molecular formula C17H26N2O5 and a molecular weight of 338.40 g/mol. Its IUPAC name is tert-butyl N-[2-(N-acetyl-3,4-dimethoxyanilino)ethyl]carbamate.
| Compound Name | tert-butyl N-[2-(N-acetyl-3,4-dimethoxyanilino)ethyl]carbamate |
|---|---|
| PubChem CID | 113061339 |
| Molecular Formula | C17H26N2O5 |
| Molecular Weight | 338.40 g/mol |
| Exact Mass | 338.18 |
| IUPAC Name | tert-butyl N-[2-(N-acetyl-3,4-dimethoxyanilino)ethyl]carbamate |
| SMILES | COc1ccc(N(CCNC(=O)OC(C)(C)C)C(C)=O)cc1OC |
| InChI | InChI=1S/C17H26N2O5/c1-12(20)19(10-9-18-16(21)24-17(2,3)4)13-7-8-14(22-5)15(11-13)23-6/h7-8,11H,9-10H2,1-6H3,(H,18,21) |
| InChIKey | AKMDJRNVKZUIRP-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.40 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |