C12H14Cl2N2O3 — CID 113063574
methyl N-[2-(N-acetyl-3,4-dichloroanilino)ethyl]carbamate (PubChem CID 113063574) has the molecular formula C12H14Cl2N2O3 and a molecular weight of 305.16 g/mol. Its IUPAC name is methyl N-[2-(N-acetyl-3,4-dichloroanilino)ethyl]carbamate.
| Compound Name | methyl N-[2-(N-acetyl-3,4-dichloroanilino)ethyl]carbamate |
|---|---|
| PubChem CID | 113063574 |
| Molecular Formula | C12H14Cl2N2O3 |
| Molecular Weight | 305.16 g/mol |
| Exact Mass | 304.04 |
| IUPAC Name | methyl N-[2-(N-acetyl-3,4-dichloroanilino)ethyl]carbamate |
| SMILES | COC(=O)NCCN(C(C)=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H14Cl2N2O3/c1-8(17)16(6-5-15-12(18)19-2)9-3-4-10(13)11(14)7-9/h3-4,7H,5-6H2,1-2H3,(H,15,18) |
| InChIKey | ZMHVTPSKWPNNQU-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.16 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |