C20H21F3N2O2 — CID 113061521
N-[2-[N-acetyl-4-(trifluoromethyl)anilino]ethyl]-2-(4-methylphenyl)acetamide (PubChem CID 113061521) has the molecular formula C20H21F3N2O2 and a molecular weight of 378.39 g/mol. Its IUPAC name is N-[2-[N-acetyl-4-(trifluoromethyl)anilino]ethyl]-2-(4-methylphenyl)acetamide.
| Compound Name | N-[2-[N-acetyl-4-(trifluoromethyl)anilino]ethyl]-2-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 113061521 |
| Molecular Formula | C20H21F3N2O2 |
| Molecular Weight | 378.39 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | N-[2-[N-acetyl-4-(trifluoromethyl)anilino]ethyl]-2-(4-methylphenyl)acetamide |
| SMILES | CC(=O)N(CCNC(=O)Cc1ccc(C)cc1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H21F3N2O2/c1-14-3-5-16(6-4-14)13-19(27)24-11-12-25(15(2)26)18-9-7-17(8-10-18)20(21,22)23/h3-10H,11-13H2,1-2H3,(H,24,27) |
| InChIKey | PMUALENCZUJTCF-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.39 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |