C24H21F3N2O2 — CID 55546186
N-[2-[(2,2-diphenylacetyl)amino]ethyl]-4-(trifluoromethyl)benzamide (PubChem CID 55546186) has the molecular formula C24H21F3N2O2 and a molecular weight of 426.44 g/mol. Its IUPAC name is N-[2-[(2,2-diphenylacetyl)amino]ethyl]-4-(trifluoromethyl)benzamide.
| Compound Name | N-[2-[(2,2-diphenylacetyl)amino]ethyl]-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 55546186 |
| Molecular Formula | C24H21F3N2O2 |
| Molecular Weight | 426.44 g/mol |
| Exact Mass | 426.16 |
| IUPAC Name | N-[2-[(2,2-diphenylacetyl)amino]ethyl]-4-(trifluoromethyl)benzamide |
| SMILES | O=C(NCCNC(=O)C(c1ccccc1)c1ccccc1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C24H21F3N2O2/c25-24(26,27)20-13-11-19(12-14-20)22(30)28-15-16-29-23(31)21(17-7-3-1-4-8-17)18-9-5-2-6-10-18/h1-14,21H,15-16H2,(H,28,30)(H,29,31) |
| InChIKey | JWGHPFWPFFJBOE-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.44 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|