C23H30F3N3O2 — CID 143988317
N-[2-[(2-amino-4-phenylbutanoyl)-methylamino]ethyl]-4-(trifluoromethyl)benzamide;ethane (PubChem CID 143988317) has the molecular formula C23H30F3N3O2 and a molecular weight of 437.51 g/mol. Its IUPAC name is N-[2-[(2-amino-4-phenylbutanoyl)-methylamino]ethyl]-4-(trifluoromethyl)benzamide;ethane.
| Compound Name | N-[2-[(2-amino-4-phenylbutanoyl)-methylamino]ethyl]-4-(trifluoromethyl)benzamide;ethane |
|---|---|
| PubChem CID | 143988317 |
| Molecular Formula | C23H30F3N3O2 |
| Molecular Weight | 437.51 g/mol |
| Exact Mass | 437.23 |
| IUPAC Name | N-[2-[(2-amino-4-phenylbutanoyl)-methylamino]ethyl]-4-(trifluoromethyl)benzamide;ethane |
| SMILES | CC.CN(CCNC(=O)c1ccc(C(F)(F)F)cc1)C(=O)C(N)CCc1ccccc1 |
| InChI | InChI=1S/C21H24F3N3O2.C2H6/c1-27(20(29)18(25)12-7-15-5-3-2-4-6-15)14-13-26-19(28)16-8-10-17(11-9-16)21(22,23)24;1-2/h2-6,8-11,18H,7,12-14,25H2,1H3,(H,26,28);1-2H3 |
| InChIKey | ALQZMAPAUFXZKQ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.51 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |