C18H20F3N2O+ — CID 2408731
dimethyl-[(1R)-1-phenyl-2-[[4-(trifluoromethyl)benzoyl]amino]ethyl]azanium (PubChem CID 2408731) has the molecular formula C18H20F3N2O+ and a molecular weight of 337.37 g/mol. Its IUPAC name is dimethyl-[(1R)-1-phenyl-2-[[4-(trifluoromethyl)benzoyl]amino]ethyl]azanium.
| Compound Name | dimethyl-[(1R)-1-phenyl-2-[[4-(trifluoromethyl)benzoyl]amino]ethyl]azanium |
|---|---|
| PubChem CID | 2408731 |
| Molecular Formula | C18H20F3N2O+ |
| Molecular Weight | 337.37 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | dimethyl-[(1R)-1-phenyl-2-[[4-(trifluoromethyl)benzoyl]amino]ethyl]azanium |
| SMILES | C[NH+](C)[C@@H](CNC(=O)c1ccc(C(F)(F)F)cc1)c1ccccc1 |
| InChI | InChI=1S/C18H19F3N2O/c1-23(2)16(13-6-4-3-5-7-13)12-22-17(24)14-8-10-15(11-9-14)18(19,20)21/h3-11,16H,12H2,1-2H3,(H,22,24)/p+1/t16-/m0/s1 |
| InChIKey | BUZBXGZTHNWLEE-INIZCTEOSA-O |
| XLogP | 2.32 |
| TPSA | 33.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.37 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |