C18H23N2O2+ — CID 2439282
[(1R)-2-benzamido-1-(4-methoxyphenyl)ethyl]-dimethylazanium (PubChem CID 2439282) has the molecular formula C18H23N2O2+ and a molecular weight of 299.39 g/mol. Its IUPAC name is [(1R)-2-benzamido-1-(4-methoxyphenyl)ethyl]-dimethylazanium.
| Compound Name | [(1R)-2-benzamido-1-(4-methoxyphenyl)ethyl]-dimethylazanium |
|---|---|
| PubChem CID | 2439282 |
| Molecular Formula | C18H23N2O2+ |
| Molecular Weight | 299.39 g/mol |
| Exact Mass | 299.18 |
| IUPAC Name | [(1R)-2-benzamido-1-(4-methoxyphenyl)ethyl]-dimethylazanium |
| SMILES | COc1ccc([C@H](CNC(=O)c2ccccc2)[NH+](C)C)cc1 |
| InChI | InChI=1S/C18H22N2O2/c1-20(2)17(14-9-11-16(22-3)12-10-14)13-19-18(21)15-7-5-4-6-8-15/h4-12,17H,13H2,1-3H3,(H,19,21)/p+1/t17-/m0/s1 |
| InChIKey | CWPTUQHSCDRCGE-KRWDZBQOSA-O |
| XLogP | 1.31 |
| TPSA | 42.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.39 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |