C23H28N3O+ — CID 7496036
[(1R)-1-[4-(dimethylamino)phenyl]-2-(naphthalene-2-carbonylamino)ethyl]-dimethylazanium (PubChem CID 7496036) has the molecular formula C23H28N3O+ and a molecular weight of 362.50 g/mol. Its IUPAC name is [(1R)-1-[4-(dimethylamino)phenyl]-2-(naphthalene-2-carbonylamino)ethyl]-dimethylazanium.
| Compound Name | [(1R)-1-[4-(dimethylamino)phenyl]-2-(naphthalene-2-carbonylamino)ethyl]-dimethylazanium |
|---|---|
| PubChem CID | 7496036 |
| Molecular Formula | C23H28N3O+ |
| Molecular Weight | 362.50 g/mol |
| Exact Mass | 362.22 |
| IUPAC Name | [(1R)-1-[4-(dimethylamino)phenyl]-2-(naphthalene-2-carbonylamino)ethyl]-dimethylazanium |
| SMILES | CN(C)c1ccc([C@H](CNC(=O)c2ccc3ccccc3c2)[NH+](C)C)cc1 |
| InChI | InChI=1S/C23H27N3O/c1-25(2)21-13-11-18(12-14-21)22(26(3)4)16-24-23(27)20-10-9-17-7-5-6-8-19(17)15-20/h5-15,22H,16H2,1-4H3,(H,24,27)/p+1/t22-/m0/s1 |
| InChIKey | CHXLIYWTNHKJQD-QFIPXVFZSA-O |
| XLogP | 2.52 |
| TPSA | 36.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.50 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|