C19H24Cl2N3O+ — CID 7495893
[(1S)-2-[(2,5-dichlorobenzoyl)amino]-1-[4-(dimethylamino)phenyl]ethyl]-dimethylazanium (PubChem CID 7495893) has the molecular formula C19H24Cl2N3O+ and a molecular weight of 381.33 g/mol. Its IUPAC name is [(1S)-2-[(2,5-dichlorobenzoyl)amino]-1-[4-(dimethylamino)phenyl]ethyl]-dimethylazanium.
| Compound Name | [(1S)-2-[(2,5-dichlorobenzoyl)amino]-1-[4-(dimethylamino)phenyl]ethyl]-dimethylazanium |
|---|---|
| PubChem CID | 7495893 |
| Molecular Formula | C19H24Cl2N3O+ |
| Molecular Weight | 381.33 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | [(1S)-2-[(2,5-dichlorobenzoyl)amino]-1-[4-(dimethylamino)phenyl]ethyl]-dimethylazanium |
| SMILES | CN(C)c1ccc([C@@H](CNC(=O)c2cc(Cl)ccc2Cl)[NH+](C)C)cc1 |
| InChI | InChI=1S/C19H23Cl2N3O/c1-23(2)15-8-5-13(6-9-15)18(24(3)4)12-22-19(25)16-11-14(20)7-10-17(16)21/h5-11,18H,12H2,1-4H3,(H,22,25)/p+1/t18-/m1/s1 |
| InChIKey | IATCGPKSXKVSSK-GOSISDBHSA-O |
| XLogP | 2.67 |
| TPSA | 36.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.33 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|