C18H31N4O2+ — CID 7639390
[(1R)-2-[[2-(tert-butylamino)-2-oxoacetyl]amino]-1-[4-(dimethylamino)phenyl]ethyl]-dimethylazanium (PubChem CID 7639390) has the molecular formula C18H31N4O2+ and a molecular weight of 335.47 g/mol. Its IUPAC name is [(1R)-2-[[2-(tert-butylamino)-2-oxoacetyl]amino]-1-[4-(dimethylamino)phenyl]ethyl]-dimethylazanium.
| Compound Name | [(1R)-2-[[2-(tert-butylamino)-2-oxoacetyl]amino]-1-[4-(dimethylamino)phenyl]ethyl]-dimethylazanium |
|---|---|
| PubChem CID | 7639390 |
| Molecular Formula | C18H31N4O2+ |
| Molecular Weight | 335.47 g/mol |
| Exact Mass | 335.24 |
| IUPAC Name | [(1R)-2-[[2-(tert-butylamino)-2-oxoacetyl]amino]-1-[4-(dimethylamino)phenyl]ethyl]-dimethylazanium |
| SMILES | CN(C)c1ccc([C@H](CNC(=O)C(=O)NC(C)(C)C)[NH+](C)C)cc1 |
| InChI | InChI=1S/C18H30N4O2/c1-18(2,3)20-17(24)16(23)19-12-15(22(6)7)13-8-10-14(11-9-13)21(4)5/h8-11,15H,12H2,1-7H3,(H,19,23)(H,20,24)/p+1/t15-/m0/s1 |
| InChIKey | MAYWERCZYISRIQ-HNNXBMFYSA-O |
| XLogP | -0.03 |
| TPSA | 65.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.47 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|