C22H30FN4O2+ — CID 7639202
[(1S)-1-[4-(dimethylamino)phenyl]-2-[[2-[2-(4-fluorophenyl)ethylamino]-2-oxoacetyl]amino]ethyl]-dimethylazanium (PubChem CID 7639202) has the molecular formula C22H30FN4O2+ and a molecular weight of 401.51 g/mol. Its IUPAC name is [(1S)-1-[4-(dimethylamino)phenyl]-2-[[2-[2-(4-fluorophenyl)ethylamino]-2-oxoacetyl]amino]ethyl]-dimethylazanium.
| Compound Name | [(1S)-1-[4-(dimethylamino)phenyl]-2-[[2-[2-(4-fluorophenyl)ethylamino]-2-oxoacetyl]amino]ethyl]-dimethylazanium |
|---|---|
| PubChem CID | 7639202 |
| Molecular Formula | C22H30FN4O2+ |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.23 |
| IUPAC Name | [(1S)-1-[4-(dimethylamino)phenyl]-2-[[2-[2-(4-fluorophenyl)ethylamino]-2-oxoacetyl]amino]ethyl]-dimethylazanium |
| SMILES | CN(C)c1ccc([C@@H](CNC(=O)C(=O)NCCc2ccc(F)cc2)[NH+](C)C)cc1 |
| InChI | InChI=1S/C22H29FN4O2/c1-26(2)19-11-7-17(8-12-19)20(27(3)4)15-25-22(29)21(28)24-14-13-16-5-9-18(23)10-6-16/h5-12,20H,13-15H2,1-4H3,(H,24,28)(H,25,29)/p+1/t20-/m1/s1 |
| InChIKey | QJRNEAYHHRIEGA-HXUWFJFHSA-O |
| XLogP | 0.55 |
| TPSA | 65.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|