C24H32N5O2+ — CID 7639281
[(1S)-1-[4-(dimethylamino)phenyl]-2-[[2-[2-(1H-indol-3-yl)ethylamino]-2-oxoacetyl]amino]ethyl]-dimethylazanium (PubChem CID 7639281) has the molecular formula C24H32N5O2+ and a molecular weight of 422.55 g/mol. Its IUPAC name is [(1S)-1-[4-(dimethylamino)phenyl]-2-[[2-[2-(1H-indol-3-yl)ethylamino]-2-oxoacetyl]amino]ethyl]-dimethylazanium.
| Compound Name | [(1S)-1-[4-(dimethylamino)phenyl]-2-[[2-[2-(1H-indol-3-yl)ethylamino]-2-oxoacetyl]amino]ethyl]-dimethylazanium |
|---|---|
| PubChem CID | 7639281 |
| Molecular Formula | C24H32N5O2+ |
| Molecular Weight | 422.55 g/mol |
| Exact Mass | 422.26 |
| IUPAC Name | [(1S)-1-[4-(dimethylamino)phenyl]-2-[[2-[2-(1H-indol-3-yl)ethylamino]-2-oxoacetyl]amino]ethyl]-dimethylazanium |
| SMILES | CN(C)c1ccc([C@@H](CNC(=O)C(=O)NCCc2c[nH]c3ccccc23)[NH+](C)C)cc1 |
| InChI | InChI=1S/C24H31N5O2/c1-28(2)19-11-9-17(10-12-19)22(29(3)4)16-27-24(31)23(30)25-14-13-18-15-26-21-8-6-5-7-20(18)21/h5-12,15,22,26H,13-14,16H2,1-4H3,(H,25,30)(H,27,31)/p+1/t22-/m1/s1 |
| InChIKey | MBTNQXAZQOLQIK-JOCHJYFZSA-O |
| XLogP | 0.89 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.55 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|