C20H22N4O2 — CID 7585548
N'-[4-(dimethylamino)phenyl]-N-[2-(1H-indol-3-yl)ethyl]oxamide (PubChem CID 7585548) has the molecular formula C20H22N4O2 and a molecular weight of 350.42 g/mol. Its IUPAC name is N'-[4-(dimethylamino)phenyl]-N-[2-(1H-indol-3-yl)ethyl]oxamide.
| Compound Name | N'-[4-(dimethylamino)phenyl]-N-[2-(1H-indol-3-yl)ethyl]oxamide |
|---|---|
| PubChem CID | 7585548 |
| Molecular Formula | C20H22N4O2 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | N'-[4-(dimethylamino)phenyl]-N-[2-(1H-indol-3-yl)ethyl]oxamide |
| SMILES | CN(C)c1ccc(NC(=O)C(=O)NCCc2c[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C20H22N4O2/c1-24(2)16-9-7-15(8-10-16)23-20(26)19(25)21-12-11-14-13-22-18-6-4-3-5-17(14)18/h3-10,13,22H,11-12H2,1-2H3,(H,21,25)(H,23,26) |
| InChIKey | HTGSZYXYIGMUTM-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 77.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|