C21H19N5O3 — CID 51043915
N-[2-(1H-indol-3-yl)ethyl]-N'-[4-(5-methyl-1,3,4-oxadiazol-2-yl)phenyl]oxamide (PubChem CID 51043915) has the molecular formula C21H19N5O3 and a molecular weight of 389.42 g/mol. Its IUPAC name is N-[2-(1H-indol-3-yl)ethyl]-N'-[4-(5-methyl-1,3,4-oxadiazol-2-yl)phenyl]oxamide.
| Compound Name | N-[2-(1H-indol-3-yl)ethyl]-N'-[4-(5-methyl-1,3,4-oxadiazol-2-yl)phenyl]oxamide |
|---|---|
| PubChem CID | 51043915 |
| Molecular Formula | C21H19N5O3 |
| Molecular Weight | 389.42 g/mol |
| Exact Mass | 389.15 |
| IUPAC Name | N-[2-(1H-indol-3-yl)ethyl]-N'-[4-(5-methyl-1,3,4-oxadiazol-2-yl)phenyl]oxamide |
| SMILES | Cc1nnc(-c2ccc(NC(=O)C(=O)NCCc3c[nH]c4ccccc34)cc2)o1 |
| InChI | InChI=1S/C21H19N5O3/c1-13-25-26-21(29-13)14-6-8-16(9-7-14)24-20(28)19(27)22-11-10-15-12-23-18-5-3-2-4-17(15)18/h2-9,12,23H,10-11H2,1H3,(H,22,27)(H,24,28) |
| InChIKey | PIHGNXPZGMZWFR-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 112.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.42 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|