C18H33N5O2+2 — CID 7639176
[(1R)-1-[4-(dimethylamino)phenyl]-2-[[2-[2-(dimethylazaniumyl)ethylamino]-2-oxoacetyl]amino]ethyl]-dimethylazanium (PubChem CID 7639176) has the molecular formula C18H33N5O2+2 and a molecular weight of 351.50 g/mol. Its IUPAC name is [(1R)-1-[4-(dimethylamino)phenyl]-2-[[2-[2-(dimethylazaniumyl)ethylamino]-2-oxoacetyl]amino]ethyl]-dimethylazanium.
| Compound Name | [(1R)-1-[4-(dimethylamino)phenyl]-2-[[2-[2-(dimethylazaniumyl)ethylamino]-2-oxoacetyl]amino]ethyl]-dimethylazanium |
|---|---|
| PubChem CID | 7639176 |
| Molecular Formula | C18H33N5O2+2 |
| Molecular Weight | 351.50 g/mol |
| Exact Mass | 351.26 |
| IUPAC Name | [(1R)-1-[4-(dimethylamino)phenyl]-2-[[2-[2-(dimethylazaniumyl)ethylamino]-2-oxoacetyl]amino]ethyl]-dimethylazanium |
| SMILES | CN(C)c1ccc([C@H](CNC(=O)C(=O)NCC[NH+](C)C)[NH+](C)C)cc1 |
| InChI | InChI=1S/C18H31N5O2/c1-21(2)12-11-19-17(24)18(25)20-13-16(23(5)6)14-7-9-15(10-8-14)22(3)4/h7-10,16H,11-13H2,1-6H3,(H,19,24)(H,20,25)/p+2/t16-/m0/s1 |
| InChIKey | ACPRMGJSKASSHQ-INIZCTEOSA-P |
| XLogP | -2.68 |
| TPSA | 70.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.50 |
| LogP ≤ 5 | -2.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|