C20H35N5O2+2 — CID 7639443
2-[[2-[[(2R)-2-[4-(dimethylamino)phenyl]-2-pyrrolidin-1-ium-1-ylethyl]amino]-2-oxoacetyl]amino]ethyl-dimethylazanium (PubChem CID 7639443) has the molecular formula C20H35N5O2+2 and a molecular weight of 377.53 g/mol. Its IUPAC name is 2-[[2-[[(2R)-2-[4-(dimethylamino)phenyl]-2-pyrrolidin-1-ium-1-ylethyl]amino]-2-oxoacetyl]amino]ethyl-dimethylazanium.
| Compound Name | 2-[[2-[[(2R)-2-[4-(dimethylamino)phenyl]-2-pyrrolidin-1-ium-1-ylethyl]amino]-2-oxoacetyl]amino]ethyl-dimethylazanium |
|---|---|
| PubChem CID | 7639443 |
| Molecular Formula | C20H35N5O2+2 |
| Molecular Weight | 377.53 g/mol |
| Exact Mass | 377.28 |
| IUPAC Name | 2-[[2-[[(2R)-2-[4-(dimethylamino)phenyl]-2-pyrrolidin-1-ium-1-ylethyl]amino]-2-oxoacetyl]amino]ethyl-dimethylazanium |
| SMILES | CN(C)c1ccc([C@H](CNC(=O)C(=O)NCC[NH+](C)C)[NH+]2CCCC2)cc1 |
| InChI | InChI=1S/C20H33N5O2/c1-23(2)14-11-21-19(26)20(27)22-15-18(25-12-5-6-13-25)16-7-9-17(10-8-16)24(3)4/h7-10,18H,5-6,11-15H2,1-4H3,(H,21,26)(H,22,27)/p+2/t18-/m0/s1 |
| InChIKey | QSLLXAPBZQBHOX-SFHVURJKSA-P |
| XLogP | -2.15 |
| TPSA | 70.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.53 |
| LogP ≤ 5 | -2.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|