C20H32N3O+ — CID 7496290
N-[(2R)-2-[4-(dimethylamino)phenyl]-2-pyrrolidin-1-ium-1-ylethyl]cyclopentanecarboxamide (PubChem CID 7496290) has the molecular formula C20H32N3O+ and a molecular weight of 330.50 g/mol. Its IUPAC name is N-[(2R)-2-[4-(dimethylamino)phenyl]-2-pyrrolidin-1-ium-1-ylethyl]cyclopentanecarboxamide.
| Compound Name | N-[(2R)-2-[4-(dimethylamino)phenyl]-2-pyrrolidin-1-ium-1-ylethyl]cyclopentanecarboxamide |
|---|---|
| PubChem CID | 7496290 |
| Molecular Formula | C20H32N3O+ |
| Molecular Weight | 330.50 g/mol |
| Exact Mass | 330.25 |
| IUPAC Name | N-[(2R)-2-[4-(dimethylamino)phenyl]-2-pyrrolidin-1-ium-1-ylethyl]cyclopentanecarboxamide |
| SMILES | CN(C)c1ccc([C@H](CNC(=O)C2CCCC2)[NH+]2CCCC2)cc1 |
| InChI | InChI=1S/C20H31N3O/c1-22(2)18-11-9-16(10-12-18)19(23-13-5-6-14-23)15-21-20(24)17-7-3-4-8-17/h9-12,17,19H,3-8,13-15H2,1-2H3,(H,21,24)/p+1/t19-/m0/s1 |
| InChIKey | AMYZCQQLTRJERI-IBGZPJMESA-O |
| XLogP | 1.78 |
| TPSA | 36.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.50 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|