C22H31N4O+ — CID 7496614
1-[(2S)-2-[4-(dimethylamino)phenyl]-2-pyrrolidin-1-ium-1-ylethyl]-3-(4-methylphenyl)urea (PubChem CID 7496614) has the molecular formula C22H31N4O+ and a molecular weight of 367.52 g/mol. Its IUPAC name is 1-[(2S)-2-[4-(dimethylamino)phenyl]-2-pyrrolidin-1-ium-1-ylethyl]-3-(4-methylphenyl)urea.
| Compound Name | 1-[(2S)-2-[4-(dimethylamino)phenyl]-2-pyrrolidin-1-ium-1-ylethyl]-3-(4-methylphenyl)urea |
|---|---|
| PubChem CID | 7496614 |
| Molecular Formula | C22H31N4O+ |
| Molecular Weight | 367.52 g/mol |
| Exact Mass | 367.25 |
| IUPAC Name | 1-[(2S)-2-[4-(dimethylamino)phenyl]-2-pyrrolidin-1-ium-1-ylethyl]-3-(4-methylphenyl)urea |
| SMILES | Cc1ccc(NC(=O)NC[C@H](c2ccc(N(C)C)cc2)[NH+]2CCCC2)cc1 |
| InChI | InChI=1S/C22H30N4O/c1-17-6-10-19(11-7-17)24-22(27)23-16-21(26-14-4-5-15-26)18-8-12-20(13-9-18)25(2)3/h6-13,21H,4-5,14-16H2,1-3H3,(H2,23,24,27)/p+1/t21-/m1/s1 |
| InChIKey | VCWFTEVLBLKBPH-OAQYLSRUSA-O |
| XLogP | 2.60 |
| TPSA | 48.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.52 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|