C22H30N3O+ — CID 7496511
N-[(2R)-2-[4-(dimethylamino)phenyl]-2-pyrrolidin-1-ium-1-ylethyl]-4-methylbenzamide (PubChem CID 7496511) has the molecular formula C22H30N3O+ and a molecular weight of 352.50 g/mol. Its IUPAC name is N-[(2R)-2-[4-(dimethylamino)phenyl]-2-pyrrolidin-1-ium-1-ylethyl]-4-methylbenzamide.
| Compound Name | N-[(2R)-2-[4-(dimethylamino)phenyl]-2-pyrrolidin-1-ium-1-ylethyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 7496511 |
| Molecular Formula | C22H30N3O+ |
| Molecular Weight | 352.50 g/mol |
| Exact Mass | 352.24 |
| IUPAC Name | N-[(2R)-2-[4-(dimethylamino)phenyl]-2-pyrrolidin-1-ium-1-ylethyl]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)NC[C@@H](c2ccc(N(C)C)cc2)[NH+]2CCCC2)cc1 |
| InChI | InChI=1S/C22H29N3O/c1-17-6-8-19(9-7-17)22(26)23-16-21(25-14-4-5-15-25)18-10-12-20(13-11-18)24(2)3/h6-13,21H,4-5,14-16H2,1-3H3,(H,23,26)/p+1/t21-/m0/s1 |
| InChIKey | FXVCKLLSPSIEOI-NRFANRHFSA-O |
| XLogP | 2.21 |
| TPSA | 36.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.50 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|