C23H34N4O+2 — CID 7497270
N-[(2S)-2-[4-(dimethylamino)phenyl]-2-(4-methylpiperazine-1,4-diium-1-yl)ethyl]-3-methylbenzamide (PubChem CID 7497270) has the molecular formula C23H34N4O+2 and a molecular weight of 382.55 g/mol. Its IUPAC name is N-[(2S)-2-[4-(dimethylamino)phenyl]-2-(4-methylpiperazine-1,4-diium-1-yl)ethyl]-3-methylbenzamide.
| Compound Name | N-[(2S)-2-[4-(dimethylamino)phenyl]-2-(4-methylpiperazine-1,4-diium-1-yl)ethyl]-3-methylbenzamide |
|---|---|
| PubChem CID | 7497270 |
| Molecular Formula | C23H34N4O+2 |
| Molecular Weight | 382.55 g/mol |
| Exact Mass | 382.27 |
| IUPAC Name | N-[(2S)-2-[4-(dimethylamino)phenyl]-2-(4-methylpiperazine-1,4-diium-1-yl)ethyl]-3-methylbenzamide |
| SMILES | Cc1cccc(C(=O)NC[C@H](c2ccc(N(C)C)cc2)[NH+]2CC[NH+](C)CC2)c1 |
| InChI | InChI=1S/C23H32N4O/c1-18-6-5-7-20(16-18)23(28)24-17-22(27-14-12-26(4)13-15-27)19-8-10-21(11-9-19)25(2)3/h5-11,16,22H,12-15,17H2,1-4H3,(H,24,28)/p+2/t22-/m1/s1 |
| InChIKey | SBSHXGZERNGMBT-JOCHJYFZSA-P |
| XLogP | -0.05 |
| TPSA | 41.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.55 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|