C22H32N4O+2 — CID 7497213
N-[(2S)-2-[4-(dimethylamino)phenyl]-2-(4-methylpiperazine-1,4-diium-1-yl)ethyl]benzamide (PubChem CID 7497213) has the molecular formula C22H32N4O+2 and a molecular weight of 368.53 g/mol. Its IUPAC name is N-[(2S)-2-[4-(dimethylamino)phenyl]-2-(4-methylpiperazine-1,4-diium-1-yl)ethyl]benzamide.
| Compound Name | N-[(2S)-2-[4-(dimethylamino)phenyl]-2-(4-methylpiperazine-1,4-diium-1-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 7497213 |
| Molecular Formula | C22H32N4O+2 |
| Molecular Weight | 368.53 g/mol |
| Exact Mass | 368.26 |
| IUPAC Name | N-[(2S)-2-[4-(dimethylamino)phenyl]-2-(4-methylpiperazine-1,4-diium-1-yl)ethyl]benzamide |
| SMILES | CN(C)c1ccc([C@@H](CNC(=O)c2ccccc2)[NH+]2CC[NH+](C)CC2)cc1 |
| InChI | InChI=1S/C22H30N4O/c1-24(2)20-11-9-18(10-12-20)21(26-15-13-25(3)14-16-26)17-23-22(27)19-7-5-4-6-8-19/h4-12,21H,13-17H2,1-3H3,(H,23,27)/p+2/t21-/m1/s1 |
| InChIKey | FFHYIVIZLWPJIZ-OAQYLSRUSA-P |
| XLogP | -0.36 |
| TPSA | 41.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.53 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|