C19H26N3O2+ — CID 7496461
N-[(2S)-2-[4-(dimethylamino)phenyl]-2-pyrrolidin-1-ium-1-ylethyl]furan-2-carboxamide (PubChem CID 7496461) has the molecular formula C19H26N3O2+ and a molecular weight of 328.44 g/mol. Its IUPAC name is N-[(2S)-2-[4-(dimethylamino)phenyl]-2-pyrrolidin-1-ium-1-ylethyl]furan-2-carboxamide.
| Compound Name | N-[(2S)-2-[4-(dimethylamino)phenyl]-2-pyrrolidin-1-ium-1-ylethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 7496461 |
| Molecular Formula | C19H26N3O2+ |
| Molecular Weight | 328.44 g/mol |
| Exact Mass | 328.20 |
| IUPAC Name | N-[(2S)-2-[4-(dimethylamino)phenyl]-2-pyrrolidin-1-ium-1-ylethyl]furan-2-carboxamide |
| SMILES | CN(C)c1ccc([C@@H](CNC(=O)c2ccco2)[NH+]2CCCC2)cc1 |
| InChI | InChI=1S/C19H25N3O2/c1-21(2)16-9-7-15(8-10-16)17(22-11-3-4-12-22)14-20-19(23)18-6-5-13-24-18/h5-10,13,17H,3-4,11-12,14H2,1-2H3,(H,20,23)/p+1/t17-/m1/s1 |
| InChIKey | FXAAXYFTTPOBPH-QGZVFWFLSA-O |
| XLogP | 1.50 |
| TPSA | 49.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.44 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|