C20H33N4O4+ — CID 7639483
N'-(2,2-dimethoxyethyl)-N-[(2S)-2-[4-(dimethylamino)phenyl]-2-pyrrolidin-1-ium-1-ylethyl]oxamide (PubChem CID 7639483) has the molecular formula C20H33N4O4+ and a molecular weight of 393.51 g/mol. Its IUPAC name is N'-(2,2-dimethoxyethyl)-N-[(2S)-2-[4-(dimethylamino)phenyl]-2-pyrrolidin-1-ium-1-ylethyl]oxamide.
| Compound Name | N'-(2,2-dimethoxyethyl)-N-[(2S)-2-[4-(dimethylamino)phenyl]-2-pyrrolidin-1-ium-1-ylethyl]oxamide |
|---|---|
| PubChem CID | 7639483 |
| Molecular Formula | C20H33N4O4+ |
| Molecular Weight | 393.51 g/mol |
| Exact Mass | 393.25 |
| IUPAC Name | N'-(2,2-dimethoxyethyl)-N-[(2S)-2-[4-(dimethylamino)phenyl]-2-pyrrolidin-1-ium-1-ylethyl]oxamide |
| SMILES | COC(CNC(=O)C(=O)NC[C@H](c1ccc(N(C)C)cc1)[NH+]1CCCC1)OC |
| InChI | InChI=1S/C20H32N4O4/c1-23(2)16-9-7-15(8-10-16)17(24-11-5-6-12-24)13-21-19(25)20(26)22-14-18(27-3)28-4/h7-10,17-18H,5-6,11-14H2,1-4H3,(H,21,25)(H,22,26)/p+1/t17-/m1/s1 |
| InChIKey | JXWSSDIMROQKTE-QGZVFWFLSA-O |
| XLogP | -0.68 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.51 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|