C20H32N3O3+ — CID 7496519
[2-[[(2R)-2-[4-(dimethylamino)phenyl]-2-pyrrolidin-1-ium-1-ylethyl]amino]-2-oxoethyl] 2-methylpropanoate (PubChem CID 7496519) has the molecular formula C20H32N3O3+ and a molecular weight of 362.49 g/mol. Its IUPAC name is [2-[[(2R)-2-[4-(dimethylamino)phenyl]-2-pyrrolidin-1-ium-1-ylethyl]amino]-2-oxoethyl] 2-methylpropanoate.
| Compound Name | [2-[[(2R)-2-[4-(dimethylamino)phenyl]-2-pyrrolidin-1-ium-1-ylethyl]amino]-2-oxoethyl] 2-methylpropanoate |
|---|---|
| PubChem CID | 7496519 |
| Molecular Formula | C20H32N3O3+ |
| Molecular Weight | 362.49 g/mol |
| Exact Mass | 362.24 |
| IUPAC Name | [2-[[(2R)-2-[4-(dimethylamino)phenyl]-2-pyrrolidin-1-ium-1-ylethyl]amino]-2-oxoethyl] 2-methylpropanoate |
| SMILES | CC(C)C(=O)OCC(=O)NC[C@@H](c1ccc(N(C)C)cc1)[NH+]1CCCC1 |
| InChI | InChI=1S/C20H31N3O3/c1-15(2)20(25)26-14-19(24)21-13-18(23-11-5-6-12-23)16-7-9-17(10-8-16)22(3)4/h7-10,15,18H,5-6,11-14H2,1-4H3,(H,21,24)/p+1/t18-/m0/s1 |
| InChIKey | CWTGCDCKBHDFRL-SFHVURJKSA-O |
| XLogP | 0.79 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.49 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|