C19H31ClN3O+ — CID 7496527
3-chloro-N-[(2R)-2-[4-(dimethylamino)phenyl]-2-pyrrolidin-1-ium-1-ylethyl]-2,2-dimethylpropanamide (PubChem CID 7496527) has the molecular formula C19H31ClN3O+ and a molecular weight of 352.93 g/mol. Its IUPAC name is 3-chloro-N-[(2R)-2-[4-(dimethylamino)phenyl]-2-pyrrolidin-1-ium-1-ylethyl]-2,2-dimethylpropanamide.
| Compound Name | 3-chloro-N-[(2R)-2-[4-(dimethylamino)phenyl]-2-pyrrolidin-1-ium-1-ylethyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 7496527 |
| Molecular Formula | C19H31ClN3O+ |
| Molecular Weight | 352.93 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | 3-chloro-N-[(2R)-2-[4-(dimethylamino)phenyl]-2-pyrrolidin-1-ium-1-ylethyl]-2,2-dimethylpropanamide |
| SMILES | CN(C)c1ccc([C@H](CNC(=O)C(C)(C)CCl)[NH+]2CCCC2)cc1 |
| InChI | InChI=1S/C19H30ClN3O/c1-19(2,14-20)18(24)21-13-17(23-11-5-6-12-23)15-7-9-16(10-8-15)22(3)4/h7-10,17H,5-6,11-14H2,1-4H3,(H,21,24)/p+1/t17-/m0/s1 |
| InChIKey | OYMZLRUCNILPLG-KRWDZBQOSA-O |
| XLogP | 1.85 |
| TPSA | 36.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.93 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|