C20H33N4O3+ — CID 7645048
N'-tert-butyl-N-[(2S)-2-[4-(dimethylamino)phenyl]-2-morpholin-4-ium-4-ylethyl]oxamide (PubChem CID 7645048) has the molecular formula C20H33N4O3+ and a molecular weight of 377.51 g/mol. Its IUPAC name is N'-tert-butyl-N-[(2S)-2-[4-(dimethylamino)phenyl]-2-morpholin-4-ium-4-ylethyl]oxamide.
| Compound Name | N'-tert-butyl-N-[(2S)-2-[4-(dimethylamino)phenyl]-2-morpholin-4-ium-4-ylethyl]oxamide |
|---|---|
| PubChem CID | 7645048 |
| Molecular Formula | C20H33N4O3+ |
| Molecular Weight | 377.51 g/mol |
| Exact Mass | 377.25 |
| IUPAC Name | N'-tert-butyl-N-[(2S)-2-[4-(dimethylamino)phenyl]-2-morpholin-4-ium-4-ylethyl]oxamide |
| SMILES | CN(C)c1ccc([C@@H](CNC(=O)C(=O)NC(C)(C)C)[NH+]2CCOCC2)cc1 |
| InChI | InChI=1S/C20H32N4O3/c1-20(2,3)22-19(26)18(25)21-14-17(24-10-12-27-13-11-24)15-6-8-16(9-7-15)23(4)5/h6-9,17H,10-14H2,1-5H3,(H,21,25)(H,22,26)/p+1/t17-/m1/s1 |
| InChIKey | YURPPBQEBOESHV-QGZVFWFLSA-O |
| XLogP | -0.26 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.51 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|