C19H32N3O2+ — CID 7496640
N-[(2R)-2-[4-(dimethylamino)phenyl]-2-morpholin-4-ium-4-ylethyl]pentanamide (PubChem CID 7496640) has the molecular formula C19H32N3O2+ and a molecular weight of 334.48 g/mol. Its IUPAC name is N-[(2R)-2-[4-(dimethylamino)phenyl]-2-morpholin-4-ium-4-ylethyl]pentanamide.
| Compound Name | N-[(2R)-2-[4-(dimethylamino)phenyl]-2-morpholin-4-ium-4-ylethyl]pentanamide |
|---|---|
| PubChem CID | 7496640 |
| Molecular Formula | C19H32N3O2+ |
| Molecular Weight | 334.48 g/mol |
| Exact Mass | 334.25 |
| IUPAC Name | N-[(2R)-2-[4-(dimethylamino)phenyl]-2-morpholin-4-ium-4-ylethyl]pentanamide |
| SMILES | CCCCC(=O)NC[C@@H](c1ccc(N(C)C)cc1)[NH+]1CCOCC1 |
| InChI | InChI=1S/C19H31N3O2/c1-4-5-6-19(23)20-15-18(22-11-13-24-14-12-22)16-7-9-17(10-8-16)21(2)3/h7-10,18H,4-6,11-15H2,1-3H3,(H,20,23)/p+1/t18-/m0/s1 |
| InChIKey | MZUBZPJHBGMKHV-SFHVURJKSA-O |
| XLogP | 1.02 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.48 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|