C16H26N3O2+ — CID 7496841
N-[(2S)-2-[4-(dimethylamino)phenyl]-2-morpholin-4-ium-4-ylethyl]acetamide (PubChem CID 7496841) has the molecular formula C16H26N3O2+ and a molecular weight of 292.40 g/mol. Its IUPAC name is N-[(2S)-2-[4-(dimethylamino)phenyl]-2-morpholin-4-ium-4-ylethyl]acetamide.
| Compound Name | N-[(2S)-2-[4-(dimethylamino)phenyl]-2-morpholin-4-ium-4-ylethyl]acetamide |
|---|---|
| PubChem CID | 7496841 |
| Molecular Formula | C16H26N3O2+ |
| Molecular Weight | 292.40 g/mol |
| Exact Mass | 292.20 |
| IUPAC Name | N-[(2S)-2-[4-(dimethylamino)phenyl]-2-morpholin-4-ium-4-ylethyl]acetamide |
| SMILES | CC(=O)NC[C@H](c1ccc(N(C)C)cc1)[NH+]1CCOCC1 |
| InChI | InChI=1S/C16H25N3O2/c1-13(20)17-12-16(19-8-10-21-11-9-19)14-4-6-15(7-5-14)18(2)3/h4-7,16H,8-12H2,1-3H3,(H,17,20)/p+1/t16-/m1/s1 |
| InChIKey | HVTYZVKQMWOBPC-MRXNPFEDSA-O |
| XLogP | -0.16 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.40 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|