C21H28N3O3+ — CID 7496993
phenyl N-[(2R)-2-[4-(dimethylamino)phenyl]-2-morpholin-4-ium-4-ylethyl]carbamate (PubChem CID 7496993) has the molecular formula C21H28N3O3+ and a molecular weight of 370.47 g/mol. Its IUPAC name is phenyl N-[(2R)-2-[4-(dimethylamino)phenyl]-2-morpholin-4-ium-4-ylethyl]carbamate.
| Compound Name | phenyl N-[(2R)-2-[4-(dimethylamino)phenyl]-2-morpholin-4-ium-4-ylethyl]carbamate |
|---|---|
| PubChem CID | 7496993 |
| Molecular Formula | C21H28N3O3+ |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.21 |
| IUPAC Name | phenyl N-[(2R)-2-[4-(dimethylamino)phenyl]-2-morpholin-4-ium-4-ylethyl]carbamate |
| SMILES | CN(C)c1ccc([C@H](CNC(=O)Oc2ccccc2)[NH+]2CCOCC2)cc1 |
| InChI | InChI=1S/C21H27N3O3/c1-23(2)18-10-8-17(9-11-18)20(24-12-14-26-15-13-24)16-22-21(25)27-19-6-4-3-5-7-19/h3-11,20H,12-16H2,1-2H3,(H,22,25)/p+1/t20-/m0/s1 |
| InChIKey | VZLIVDZRJILCSA-FQEVSTJZSA-O |
| XLogP | 1.50 |
| TPSA | 55.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|