C19H32N3O+ — CID 7496443
N-[(2S)-2-[4-(dimethylamino)phenyl]-2-pyrrolidin-1-ium-1-ylethyl]-2,2-dimethylpropanamide (PubChem CID 7496443) has the molecular formula C19H32N3O+ and a molecular weight of 318.49 g/mol. Its IUPAC name is N-[(2S)-2-[4-(dimethylamino)phenyl]-2-pyrrolidin-1-ium-1-ylethyl]-2,2-dimethylpropanamide.
| Compound Name | N-[(2S)-2-[4-(dimethylamino)phenyl]-2-pyrrolidin-1-ium-1-ylethyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 7496443 |
| Molecular Formula | C19H32N3O+ |
| Molecular Weight | 318.49 g/mol |
| Exact Mass | 318.25 |
| IUPAC Name | N-[(2S)-2-[4-(dimethylamino)phenyl]-2-pyrrolidin-1-ium-1-ylethyl]-2,2-dimethylpropanamide |
| SMILES | CN(C)c1ccc([C@@H](CNC(=O)C(C)(C)C)[NH+]2CCCC2)cc1 |
| InChI | InChI=1S/C19H31N3O/c1-19(2,3)18(23)20-14-17(22-12-6-7-13-22)15-8-10-16(11-9-15)21(4)5/h8-11,17H,6-7,12-14H2,1-5H3,(H,20,23)/p+1/t17-/m1/s1 |
| InChIKey | UVOWUHRBJSGMGO-QGZVFWFLSA-O |
| XLogP | 1.63 |
| TPSA | 36.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.49 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|