C20H33ClN4O — CID 7497289
3-chloro-N-[(2R)-2-[4-(dimethylamino)phenyl]-2-(4-methylpiperazin-1-yl)ethyl]-2,2-dimethylpropanamide (PubChem CID 7497289) has the molecular formula C20H33ClN4O and a molecular weight of 380.96 g/mol. Its IUPAC name is 3-chloro-N-[(2R)-2-[4-(dimethylamino)phenyl]-2-(4-methylpiperazin-1-yl)ethyl]-2,2-dimethylpropanamide.
| Compound Name | 3-chloro-N-[(2R)-2-[4-(dimethylamino)phenyl]-2-(4-methylpiperazin-1-yl)ethyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 7497289 |
| Molecular Formula | C20H33ClN4O |
| Molecular Weight | 380.96 g/mol |
| Exact Mass | 380.23 |
| IUPAC Name | 3-chloro-N-[(2R)-2-[4-(dimethylamino)phenyl]-2-(4-methylpiperazin-1-yl)ethyl]-2,2-dimethylpropanamide |
| SMILES | CN1CCN([C@@H](CNC(=O)C(C)(C)CCl)c2ccc(N(C)C)cc2)CC1 |
| InChI | InChI=1S/C20H33ClN4O/c1-20(2,15-21)19(26)22-14-18(25-12-10-24(5)11-13-25)16-6-8-17(9-7-16)23(3)4/h6-9,18H,10-15H2,1-5H3,(H,22,26)/t18-/m0/s1 |
| InChIKey | LRPYPUDLHVQDAH-SFHVURJKSA-N |
| XLogP | 2.42 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.96 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|