C19H32N4O — CID 7497230
N-[(2S)-2-[4-(dimethylamino)phenyl]-2-(4-methylpiperazin-1-yl)ethyl]-2-methylpropanamide (PubChem CID 7497230) has the molecular formula C19H32N4O and a molecular weight of 332.49 g/mol. Its IUPAC name is N-[(2S)-2-[4-(dimethylamino)phenyl]-2-(4-methylpiperazin-1-yl)ethyl]-2-methylpropanamide.
| Compound Name | N-[(2S)-2-[4-(dimethylamino)phenyl]-2-(4-methylpiperazin-1-yl)ethyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 7497230 |
| Molecular Formula | C19H32N4O |
| Molecular Weight | 332.49 g/mol |
| Exact Mass | 332.26 |
| IUPAC Name | N-[(2S)-2-[4-(dimethylamino)phenyl]-2-(4-methylpiperazin-1-yl)ethyl]-2-methylpropanamide |
| SMILES | CC(C)C(=O)NC[C@H](c1ccc(N(C)C)cc1)N1CCN(C)CC1 |
| InChI | InChI=1S/C19H32N4O/c1-15(2)19(24)20-14-18(23-12-10-22(5)11-13-23)16-6-8-17(9-7-16)21(3)4/h6-9,15,18H,10-14H2,1-5H3,(H,20,24)/t18-/m1/s1 |
| InChIKey | GRLADROGYKHTIV-GOSISDBHSA-N |
| XLogP | 1.81 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.49 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|