C22H28BrClN4O — CID 43956712
5-bromo-2-chloro-N-[2-[4-(dimethylamino)phenyl]-2-(4-methylpiperazin-1-yl)ethyl]benzamide (PubChem CID 43956712) has the molecular formula C22H28BrClN4O and a molecular weight of 479.85 g/mol. Its IUPAC name is 5-bromo-2-chloro-N-[2-[4-(dimethylamino)phenyl]-2-(4-methylpiperazin-1-yl)ethyl]benzamide.
| Compound Name | 5-bromo-2-chloro-N-[2-[4-(dimethylamino)phenyl]-2-(4-methylpiperazin-1-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 43956712 |
| Molecular Formula | C22H28BrClN4O |
| Molecular Weight | 479.85 g/mol |
| Exact Mass | 478.11 |
| IUPAC Name | 5-bromo-2-chloro-N-[2-[4-(dimethylamino)phenyl]-2-(4-methylpiperazin-1-yl)ethyl]benzamide |
| SMILES | CN1CCN(C(CNC(=O)c2cc(Br)ccc2Cl)c2ccc(N(C)C)cc2)CC1 |
| InChI | InChI=1S/C22H28BrClN4O/c1-26(2)18-7-4-16(5-8-18)21(28-12-10-27(3)11-13-28)15-25-22(29)19-14-17(23)6-9-20(19)24/h4-9,14,21H,10-13,15H2,1-3H3,(H,25,29) |
| InChIKey | OHQCMIFICDHUAU-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.85 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|