C25H30N4O3 — CID 51628649
N-[(2R)-2-[4-(dimethylamino)phenyl]-2-(4-methylpiperazin-1-yl)ethyl]-2-oxochromene-3-carboxamide (PubChem CID 51628649) has the molecular formula C25H30N4O3 and a molecular weight of 434.54 g/mol. Its IUPAC name is N-[(2R)-2-[4-(dimethylamino)phenyl]-2-(4-methylpiperazin-1-yl)ethyl]-2-oxochromene-3-carboxamide.
| Compound Name | N-[(2R)-2-[4-(dimethylamino)phenyl]-2-(4-methylpiperazin-1-yl)ethyl]-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 51628649 |
| Molecular Formula | C25H30N4O3 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.23 |
| IUPAC Name | N-[(2R)-2-[4-(dimethylamino)phenyl]-2-(4-methylpiperazin-1-yl)ethyl]-2-oxochromene-3-carboxamide |
| SMILES | CN1CCN([C@@H](CNC(=O)c2cc3ccccc3oc2=O)c2ccc(N(C)C)cc2)CC1 |
| InChI | InChI=1S/C25H30N4O3/c1-27(2)20-10-8-18(9-11-20)22(29-14-12-28(3)13-15-29)17-26-24(30)21-16-19-6-4-5-7-23(19)32-25(21)31/h4-11,16,22H,12-15,17H2,1-3H3,(H,26,30)/t22-/m0/s1 |
| InChIKey | SEGJWZKNURQOTB-QFIPXVFZSA-N |
| XLogP | 2.58 |
| TPSA | 69.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|