C24H26N2O4 — CID 40849817
N-[(2S)-2-(4-methoxyphenyl)-2-piperidin-1-ylethyl]-2-oxochromene-3-carboxamide (PubChem CID 40849817) has the molecular formula C24H26N2O4 and a molecular weight of 406.48 g/mol. Its IUPAC name is N-[(2S)-2-(4-methoxyphenyl)-2-piperidin-1-ylethyl]-2-oxochromene-3-carboxamide.
| Compound Name | N-[(2S)-2-(4-methoxyphenyl)-2-piperidin-1-ylethyl]-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 40849817 |
| Molecular Formula | C24H26N2O4 |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | N-[(2S)-2-(4-methoxyphenyl)-2-piperidin-1-ylethyl]-2-oxochromene-3-carboxamide |
| SMILES | COc1ccc([C@@H](CNC(=O)c2cc3ccccc3oc2=O)N2CCCCC2)cc1 |
| InChI | InChI=1S/C24H26N2O4/c1-29-19-11-9-17(10-12-19)21(26-13-5-2-6-14-26)16-25-23(27)20-15-18-7-3-4-8-22(18)30-24(20)28/h3-4,7-12,15,21H,2,5-6,13-14,16H2,1H3,(H,25,27)/t21-/m1/s1 |
| InChIKey | DGKIEZUGTSMSOJ-OAQYLSRUSA-N |
| XLogP | 3.76 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|