C24H34N3O3+ — CID 7496484
2-(3,4-dimethoxyphenyl)-N-[(2R)-2-[4-(dimethylamino)phenyl]-2-pyrrolidin-1-ium-1-ylethyl]acetamide (PubChem CID 7496484) has the molecular formula C24H34N3O3+ and a molecular weight of 412.55 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-N-[(2R)-2-[4-(dimethylamino)phenyl]-2-pyrrolidin-1-ium-1-ylethyl]acetamide.
| Compound Name | 2-(3,4-dimethoxyphenyl)-N-[(2R)-2-[4-(dimethylamino)phenyl]-2-pyrrolidin-1-ium-1-ylethyl]acetamide |
|---|---|
| PubChem CID | 7496484 |
| Molecular Formula | C24H34N3O3+ |
| Molecular Weight | 412.55 g/mol |
| Exact Mass | 412.26 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-N-[(2R)-2-[4-(dimethylamino)phenyl]-2-pyrrolidin-1-ium-1-ylethyl]acetamide |
| SMILES | COc1ccc(CC(=O)NC[C@@H](c2ccc(N(C)C)cc2)[NH+]2CCCC2)cc1OC |
| InChI | InChI=1S/C24H33N3O3/c1-26(2)20-10-8-19(9-11-20)21(27-13-5-6-14-27)17-25-24(28)16-18-7-12-22(29-3)23(15-18)30-4/h7-12,15,21H,5-6,13-14,16-17H2,1-4H3,(H,25,28)/p+1/t21-/m0/s1 |
| InChIKey | KJYFLRXQAWHHRO-NRFANRHFSA-O |
| XLogP | 1.85 |
| TPSA | 55.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.55 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|