C23H32N3O3+ — CID 7496469
N-[(2S)-2-[4-(dimethylamino)phenyl]-2-pyrrolidin-1-ium-1-ylethyl]-2,4-dimethoxybenzamide (PubChem CID 7496469) has the molecular formula C23H32N3O3+ and a molecular weight of 398.53 g/mol. Its IUPAC name is N-[(2S)-2-[4-(dimethylamino)phenyl]-2-pyrrolidin-1-ium-1-ylethyl]-2,4-dimethoxybenzamide.
| Compound Name | N-[(2S)-2-[4-(dimethylamino)phenyl]-2-pyrrolidin-1-ium-1-ylethyl]-2,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 7496469 |
| Molecular Formula | C23H32N3O3+ |
| Molecular Weight | 398.53 g/mol |
| Exact Mass | 398.24 |
| IUPAC Name | N-[(2S)-2-[4-(dimethylamino)phenyl]-2-pyrrolidin-1-ium-1-ylethyl]-2,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)NC[C@H](c2ccc(N(C)C)cc2)[NH+]2CCCC2)c(OC)c1 |
| InChI | InChI=1S/C23H31N3O3/c1-25(2)18-9-7-17(8-10-18)21(26-13-5-6-14-26)16-24-23(27)20-12-11-19(28-3)15-22(20)29-4/h7-12,15,21H,5-6,13-14,16H2,1-4H3,(H,24,27)/p+1/t21-/m1/s1 |
| InChIKey | KSKBHFWWHCAJBF-OAQYLSRUSA-O |
| XLogP | 1.92 |
| TPSA | 55.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.53 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|