C24H35N5O2+2 — CID 7645058
N-benzyl-N'-[(2R)-2-[4-(dimethylamino)phenyl]-2-(4-methylpiperazine-1,4-diium-1-yl)ethyl]oxamide (PubChem CID 7645058) has the molecular formula C24H35N5O2+2 and a molecular weight of 425.58 g/mol. Its IUPAC name is N-benzyl-N'-[(2R)-2-[4-(dimethylamino)phenyl]-2-(4-methylpiperazine-1,4-diium-1-yl)ethyl]oxamide.
| Compound Name | N-benzyl-N'-[(2R)-2-[4-(dimethylamino)phenyl]-2-(4-methylpiperazine-1,4-diium-1-yl)ethyl]oxamide |
|---|---|
| PubChem CID | 7645058 |
| Molecular Formula | C24H35N5O2+2 |
| Molecular Weight | 425.58 g/mol |
| Exact Mass | 425.28 |
| IUPAC Name | N-benzyl-N'-[(2R)-2-[4-(dimethylamino)phenyl]-2-(4-methylpiperazine-1,4-diium-1-yl)ethyl]oxamide |
| SMILES | CN(C)c1ccc([C@H](CNC(=O)C(=O)NCc2ccccc2)[NH+]2CC[NH+](C)CC2)cc1 |
| InChI | InChI=1S/C24H33N5O2/c1-27(2)21-11-9-20(10-12-21)22(29-15-13-28(3)14-16-29)18-26-24(31)23(30)25-17-19-7-5-4-6-8-19/h4-12,22H,13-18H2,1-3H3,(H,25,30)(H,26,31)/p+2/t22-/m0/s1 |
| InChIKey | VUGTYCXPIXAPNJ-QFIPXVFZSA-P |
| XLogP | -1.36 |
| TPSA | 70.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.58 |
| LogP ≤ 5 | -1.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|