C19H32N4O+2 — CID 7497082
N-[(2R)-2-[4-(dimethylamino)phenyl]-2-(4-methylpiperazine-1,4-diium-1-yl)ethyl]cyclopropanecarboxamide (PubChem CID 7497082) has the molecular formula C19H32N4O+2 and a molecular weight of 332.49 g/mol. Its IUPAC name is N-[(2R)-2-[4-(dimethylamino)phenyl]-2-(4-methylpiperazine-1,4-diium-1-yl)ethyl]cyclopropanecarboxamide.
| Compound Name | N-[(2R)-2-[4-(dimethylamino)phenyl]-2-(4-methylpiperazine-1,4-diium-1-yl)ethyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 7497082 |
| Molecular Formula | C19H32N4O+2 |
| Molecular Weight | 332.49 g/mol |
| Exact Mass | 332.26 |
| IUPAC Name | N-[(2R)-2-[4-(dimethylamino)phenyl]-2-(4-methylpiperazine-1,4-diium-1-yl)ethyl]cyclopropanecarboxamide |
| SMILES | CN(C)c1ccc([C@H](CNC(=O)C2CC2)[NH+]2CC[NH+](C)CC2)cc1 |
| InChI | InChI=1S/C19H30N4O/c1-21(2)17-8-6-15(7-9-17)18(14-20-19(24)16-4-5-16)23-12-10-22(3)11-13-23/h6-9,16,18H,4-5,10-14H2,1-3H3,(H,20,24)/p+2/t18-/m0/s1 |
| InChIKey | GKVDXVZUTLBCKB-SFHVURJKSA-P |
| XLogP | -1.27 |
| TPSA | 41.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.49 |
| LogP ≤ 5 | -1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|