C17H32N4O2S+2 — CID 7498324
N-[(2R)-2-[4-(dimethylamino)phenyl]-2-(4-methylpiperazine-1,4-diium-1-yl)ethyl]ethanesulfonamide (PubChem CID 7498324) has the molecular formula C17H32N4O2S+2 and a molecular weight of 356.54 g/mol. Its IUPAC name is N-[(2R)-2-[4-(dimethylamino)phenyl]-2-(4-methylpiperazine-1,4-diium-1-yl)ethyl]ethanesulfonamide.
| Compound Name | N-[(2R)-2-[4-(dimethylamino)phenyl]-2-(4-methylpiperazine-1,4-diium-1-yl)ethyl]ethanesulfonamide |
|---|---|
| PubChem CID | 7498324 |
| Molecular Formula | C17H32N4O2S+2 |
| Molecular Weight | 356.54 g/mol |
| Exact Mass | 356.22 |
| IUPAC Name | N-[(2R)-2-[4-(dimethylamino)phenyl]-2-(4-methylpiperazine-1,4-diium-1-yl)ethyl]ethanesulfonamide |
| SMILES | CCS(=O)(=O)NC[C@@H](c1ccc(N(C)C)cc1)[NH+]1CC[NH+](C)CC1 |
| InChI | InChI=1S/C17H30N4O2S/c1-5-24(22,23)18-14-17(21-12-10-20(4)11-13-21)15-6-8-16(9-7-15)19(2)3/h6-9,17-18H,5,10-14H2,1-4H3/p+2/t17-/m0/s1 |
| InChIKey | TXQNZJMGIHLVNA-KRWDZBQOSA-P |
| XLogP | -1.85 |
| TPSA | 58.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.54 |
| LogP ≤ 5 | -1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|