C16H29ClN4O2S+2 — CID 7498375
1-chloro-N-[(2R)-2-[4-(dimethylamino)phenyl]-2-(4-methylpiperazine-1,4-diium-1-yl)ethyl]methanesulfonamide (PubChem CID 7498375) has the molecular formula C16H29ClN4O2S+2 and a molecular weight of 376.95 g/mol. Its IUPAC name is 1-chloro-N-[(2R)-2-[4-(dimethylamino)phenyl]-2-(4-methylpiperazine-1,4-diium-1-yl)ethyl]methanesulfonamide.
| Compound Name | 1-chloro-N-[(2R)-2-[4-(dimethylamino)phenyl]-2-(4-methylpiperazine-1,4-diium-1-yl)ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 7498375 |
| Molecular Formula | C16H29ClN4O2S+2 |
| Molecular Weight | 376.95 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | 1-chloro-N-[(2R)-2-[4-(dimethylamino)phenyl]-2-(4-methylpiperazine-1,4-diium-1-yl)ethyl]methanesulfonamide |
| SMILES | CN(C)c1ccc([C@H](CNS(=O)(=O)CCl)[NH+]2CC[NH+](C)CC2)cc1 |
| InChI | InChI=1S/C16H27ClN4O2S/c1-19(2)15-6-4-14(5-7-15)16(12-18-24(22,23)13-17)21-10-8-20(3)9-11-21/h4-7,16,18H,8-13H2,1-3H3/p+2/t16-/m0/s1 |
| InChIKey | ZDFTZXOBSNVMIS-INIZCTEOSA-P |
| XLogP | -1.68 |
| TPSA | 58.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.95 |
| LogP ≤ 5 | -1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|