C18H30N3O+ — CID 7495828
[(1S)-2-(cyclopentanecarbonylamino)-1-[4-(dimethylamino)phenyl]ethyl]-dimethylazanium (PubChem CID 7495828) has the molecular formula C18H30N3O+ and a molecular weight of 304.46 g/mol. Its IUPAC name is [(1S)-2-(cyclopentanecarbonylamino)-1-[4-(dimethylamino)phenyl]ethyl]-dimethylazanium.
| Compound Name | [(1S)-2-(cyclopentanecarbonylamino)-1-[4-(dimethylamino)phenyl]ethyl]-dimethylazanium |
|---|---|
| PubChem CID | 7495828 |
| Molecular Formula | C18H30N3O+ |
| Molecular Weight | 304.46 g/mol |
| Exact Mass | 304.24 |
| IUPAC Name | [(1S)-2-(cyclopentanecarbonylamino)-1-[4-(dimethylamino)phenyl]ethyl]-dimethylazanium |
| SMILES | CN(C)c1ccc([C@@H](CNC(=O)C2CCCC2)[NH+](C)C)cc1 |
| InChI | InChI=1S/C18H29N3O/c1-20(2)16-11-9-14(10-12-16)17(21(3)4)13-19-18(22)15-7-5-6-8-15/h9-12,15,17H,5-8,13H2,1-4H3,(H,19,22)/p+1/t17-/m1/s1 |
| InChIKey | VHTQUCDHCUJSAJ-QGZVFWFLSA-O |
| XLogP | 1.24 |
| TPSA | 36.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.46 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|