C20H26ClN4O2+ — CID 7192147
[(1S)-2-[[2-(3-chloroanilino)-2-oxoacetyl]amino]-1-[4-(dimethylamino)phenyl]ethyl]-dimethylazanium (PubChem CID 7192147) has the molecular formula C20H26ClN4O2+ and a molecular weight of 389.91 g/mol. Its IUPAC name is [(1S)-2-[[2-(3-chloroanilino)-2-oxoacetyl]amino]-1-[4-(dimethylamino)phenyl]ethyl]-dimethylazanium.
| Compound Name | [(1S)-2-[[2-(3-chloroanilino)-2-oxoacetyl]amino]-1-[4-(dimethylamino)phenyl]ethyl]-dimethylazanium |
|---|---|
| PubChem CID | 7192147 |
| Molecular Formula | C20H26ClN4O2+ |
| Molecular Weight | 389.91 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | [(1S)-2-[[2-(3-chloroanilino)-2-oxoacetyl]amino]-1-[4-(dimethylamino)phenyl]ethyl]-dimethylazanium |
| SMILES | CN(C)c1ccc([C@@H](CNC(=O)C(=O)Nc2cccc(Cl)c2)[NH+](C)C)cc1 |
| InChI | InChI=1S/C20H25ClN4O2/c1-24(2)17-10-8-14(9-11-17)18(25(3)4)13-22-19(26)20(27)23-16-7-5-6-15(21)12-16/h5-12,18H,13H2,1-4H3,(H,22,26)(H,23,27)/p+1/t18-/m1/s1 |
| InChIKey | FENRCNVNHRNXDQ-GOSISDBHSA-O |
| XLogP | 1.35 |
| TPSA | 65.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.91 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|