C22H22ClN3O2 — CID 41454514
N'-(3-chlorophenyl)-N-[(2S)-2-(dimethylamino)-2-naphthalen-1-ylethyl]oxamide (PubChem CID 41454514) has the molecular formula C22H22ClN3O2 and a molecular weight of 395.89 g/mol. Its IUPAC name is N'-(3-chlorophenyl)-N-[(2S)-2-(dimethylamino)-2-naphthalen-1-ylethyl]oxamide.
| Compound Name | N'-(3-chlorophenyl)-N-[(2S)-2-(dimethylamino)-2-naphthalen-1-ylethyl]oxamide |
|---|---|
| PubChem CID | 41454514 |
| Molecular Formula | C22H22ClN3O2 |
| Molecular Weight | 395.89 g/mol |
| Exact Mass | 395.14 |
| IUPAC Name | N'-(3-chlorophenyl)-N-[(2S)-2-(dimethylamino)-2-naphthalen-1-ylethyl]oxamide |
| SMILES | CN(C)[C@H](CNC(=O)C(=O)Nc1cccc(Cl)c1)c1cccc2ccccc12 |
| InChI | InChI=1S/C22H22ClN3O2/c1-26(2)20(19-12-5-8-15-7-3-4-11-18(15)19)14-24-21(27)22(28)25-17-10-6-9-16(23)13-17/h3-13,20H,14H2,1-2H3,(H,24,27)(H,25,28)/t20-/m1/s1 |
| InChIKey | MNCVOCBYYMUFAI-HXUWFJFHSA-N |
| XLogP | 3.85 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.89 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|