C22H21FN4O4 — CID 41454568
N-[(2R)-2-(dimethylamino)-2-naphthalen-1-ylethyl]-N'-(4-fluoro-3-nitrophenyl)oxamide (PubChem CID 41454568) has the molecular formula C22H21FN4O4 and a molecular weight of 424.43 g/mol. Its IUPAC name is N-[(2R)-2-(dimethylamino)-2-naphthalen-1-ylethyl]-N'-(4-fluoro-3-nitrophenyl)oxamide.
| Compound Name | N-[(2R)-2-(dimethylamino)-2-naphthalen-1-ylethyl]-N'-(4-fluoro-3-nitrophenyl)oxamide |
|---|---|
| PubChem CID | 41454568 |
| Molecular Formula | C22H21FN4O4 |
| Molecular Weight | 424.43 g/mol |
| Exact Mass | 424.15 |
| IUPAC Name | N-[(2R)-2-(dimethylamino)-2-naphthalen-1-ylethyl]-N'-(4-fluoro-3-nitrophenyl)oxamide |
| SMILES | CN(C)[C@@H](CNC(=O)C(=O)Nc1ccc(F)c([N+](=O)[O-])c1)c1cccc2ccccc12 |
| InChI | InChI=1S/C22H21FN4O4/c1-26(2)20(17-9-5-7-14-6-3-4-8-16(14)17)13-24-21(28)22(29)25-15-10-11-18(23)19(12-15)27(30)31/h3-12,20H,13H2,1-2H3,(H,24,28)(H,25,29)/t20-/m0/s1 |
| InChIKey | RYLLLUGJXUEGBO-FQEVSTJZSA-N |
| XLogP | 3.24 |
| TPSA | 104.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.43 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|