C21H23FN4O2 — CID 90490965
N-[2-(dimethylamino)-2-(1-methylindol-3-yl)ethyl]-N'-(3-fluorophenyl)oxamide (PubChem CID 90490965) has the molecular formula C21H23FN4O2 and a molecular weight of 382.44 g/mol. Its IUPAC name is N-[2-(dimethylamino)-2-(1-methylindol-3-yl)ethyl]-N'-(3-fluorophenyl)oxamide.
| Compound Name | N-[2-(dimethylamino)-2-(1-methylindol-3-yl)ethyl]-N'-(3-fluorophenyl)oxamide |
|---|---|
| PubChem CID | 90490965 |
| Molecular Formula | C21H23FN4O2 |
| Molecular Weight | 382.44 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | N-[2-(dimethylamino)-2-(1-methylindol-3-yl)ethyl]-N'-(3-fluorophenyl)oxamide |
| SMILES | CN(C)C(CNC(=O)C(=O)Nc1cccc(F)c1)c1cn(C)c2ccccc12 |
| InChI | InChI=1S/C21H23FN4O2/c1-25(2)19(17-13-26(3)18-10-5-4-9-16(17)18)12-23-20(27)21(28)24-15-8-6-7-14(22)11-15/h4-11,13,19H,12H2,1-3H3,(H,23,27)(H,24,28) |
| InChIKey | YHVMQKNSJZZIKZ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 66.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.44 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|