C20H21ClFN3O — CID 30945646
2-chloro-N-[(2R)-2-(dimethylamino)-2-(1-methylindol-3-yl)ethyl]-6-fluorobenzamide (PubChem CID 30945646) has the molecular formula C20H21ClFN3O and a molecular weight of 373.86 g/mol. Its IUPAC name is 2-chloro-N-[(2R)-2-(dimethylamino)-2-(1-methylindol-3-yl)ethyl]-6-fluorobenzamide.
| Compound Name | 2-chloro-N-[(2R)-2-(dimethylamino)-2-(1-methylindol-3-yl)ethyl]-6-fluorobenzamide |
|---|---|
| PubChem CID | 30945646 |
| Molecular Formula | C20H21ClFN3O |
| Molecular Weight | 373.86 g/mol |
| Exact Mass | 373.14 |
| IUPAC Name | 2-chloro-N-[(2R)-2-(dimethylamino)-2-(1-methylindol-3-yl)ethyl]-6-fluorobenzamide |
| SMILES | CN(C)[C@@H](CNC(=O)c1c(F)cccc1Cl)c1cn(C)c2ccccc12 |
| InChI | InChI=1S/C20H21ClFN3O/c1-24(2)18(14-12-25(3)17-10-5-4-7-13(14)17)11-23-20(26)19-15(21)8-6-9-16(19)22/h4-10,12,18H,11H2,1-3H3,(H,23,26)/t18-/m0/s1 |
| InChIKey | SBWLNEJCHBKYSE-SFHVURJKSA-N |
| XLogP | 4.00 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.86 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |