C19H29N5O2 — CID 90491021
N-[2-(dimethylamino)ethyl]-N'-[2-(dimethylamino)-2-(1-methylindol-3-yl)ethyl]oxamide (PubChem CID 90491021) has the molecular formula C19H29N5O2 and a molecular weight of 359.47 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-N'-[2-(dimethylamino)-2-(1-methylindol-3-yl)ethyl]oxamide.
| Compound Name | N-[2-(dimethylamino)ethyl]-N'-[2-(dimethylamino)-2-(1-methylindol-3-yl)ethyl]oxamide |
|---|---|
| PubChem CID | 90491021 |
| Molecular Formula | C19H29N5O2 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.23 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-N'-[2-(dimethylamino)-2-(1-methylindol-3-yl)ethyl]oxamide |
| SMILES | CN(C)CCNC(=O)C(=O)NCC(c1cn(C)c2ccccc12)N(C)C |
| InChI | InChI=1S/C19H29N5O2/c1-22(2)11-10-20-18(25)19(26)21-12-17(23(3)4)15-13-24(5)16-9-7-6-8-14(15)16/h6-9,13,17H,10-12H2,1-5H3,(H,20,25)(H,21,26) |
| InChIKey | PQJVQHKYEKRWIF-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 69.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|